C16H16FN3O3S — CID 110873999
4-fluoro-3-methyl-N-[4-(2-oxoimidazolidin-1-yl)phenyl]benzenesulfonamide (PubChem CID 110873999) has the molecular formula C16H16FN3O3S and a molecular weight of 349.39 g/mol. Its IUPAC name is 4-fluoro-3-methyl-N-[4-(2-oxoimidazolidin-1-yl)phenyl]benzenesulfonamide.
| Compound Name | 4-fluoro-3-methyl-N-[4-(2-oxoimidazolidin-1-yl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 110873999 |
| Molecular Formula | C16H16FN3O3S |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.09 |
| IUPAC Name | 4-fluoro-3-methyl-N-[4-(2-oxoimidazolidin-1-yl)phenyl]benzenesulfonamide |
| SMILES | Cc1cc(S(=O)(=O)Nc2ccc(N3CCNC3=O)cc2)ccc1F |
| InChI | InChI=1S/C16H16FN3O3S/c1-11-10-14(6-7-15(11)17)24(22,23)19-12-2-4-13(5-3-12)20-9-8-18-16(20)21/h2-7,10,19H,8-9H2,1H3,(H,18,21) |
| InChIKey | CXGWLDPRACGOES-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |