C28H24F2N2O6S2 — CID 3427654
[4-[[(4-acetamidophenyl)sulfonyl-[(4-fluorophenyl)methyl]amino]methyl]phenyl] 4-fluorobenzenesulfonate (PubChem CID 3427654) has the molecular formula C28H24F2N2O6S2 and a molecular weight of 586.64 g/mol. Its IUPAC name is [4-[[(4-acetamidophenyl)sulfonyl-[(4-fluorophenyl)methyl]amino]methyl]phenyl] 4-fluorobenzenesulfonate.
| Compound Name | [4-[[(4-acetamidophenyl)sulfonyl-[(4-fluorophenyl)methyl]amino]methyl]phenyl] 4-fluorobenzenesulfonate |
|---|---|
| PubChem CID | 3427654 |
| Molecular Formula | C28H24F2N2O6S2 |
| Molecular Weight | 586.64 g/mol |
| Exact Mass | 586.10 |
| IUPAC Name | [4-[[(4-acetamidophenyl)sulfonyl-[(4-fluorophenyl)methyl]amino]methyl]phenyl] 4-fluorobenzenesulfonate |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)N(Cc2ccc(F)cc2)Cc2ccc(OS(=O)(=O)c3ccc(F)cc3)cc2)cc1 |
| InChI | InChI=1S/C28H24F2N2O6S2/c1-20(33)31-25-10-16-27(17-11-25)39(34,35)32(18-21-2-6-23(29)7-3-21)19-22-4-12-26(13-5-22)38-40(36,37)28-14-8-24(30)9-15-28/h2-17H,18-19H2,1H3,(H,31,33) |
| InChIKey | OPDNJANQSKLMSY-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.64 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|