C28H27FN4O3S2 — CID 175587774
1-[4-[(4-fluorophenyl)methyl-[(4-methoxyphenyl)methyl]sulfamoyl]phenyl]-3-(pyridin-4-ylmethyl)thiourea (PubChem CID 175587774) has the molecular formula C28H27FN4O3S2 and a molecular weight of 550.68 g/mol. Its IUPAC name is 1-[4-[(4-fluorophenyl)methyl-[(4-methoxyphenyl)methyl]sulfamoyl]phenyl]-3-(pyridin-4-ylmethyl)thiourea.
| Compound Name | 1-[4-[(4-fluorophenyl)methyl-[(4-methoxyphenyl)methyl]sulfamoyl]phenyl]-3-(pyridin-4-ylmethyl)thiourea |
|---|---|
| PubChem CID | 175587774 |
| Molecular Formula | C28H27FN4O3S2 |
| Molecular Weight | 550.68 g/mol |
| Exact Mass | 550.15 |
| IUPAC Name | 1-[4-[(4-fluorophenyl)methyl-[(4-methoxyphenyl)methyl]sulfamoyl]phenyl]-3-(pyridin-4-ylmethyl)thiourea |
| SMILES | COc1ccc(CN(Cc2ccc(F)cc2)S(=O)(=O)c2ccc(NC(=S)NCc3ccncc3)cc2)cc1 |
| InChI | InChI=1S/C28H27FN4O3S2/c1-36-26-10-4-23(5-11-26)20-33(19-22-2-6-24(29)7-3-22)38(34,35)27-12-8-25(9-13-27)32-28(37)31-18-21-14-16-30-17-15-21/h2-17H,18-20H2,1H3,(H2,31,32,37) |
| InChIKey | VJSQIDHBVFXVHO-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.68 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|