C29H28N4O4S2 — CID 23661275
1-[4-(dibenzylsulfamoyl)phenyl]-3-[(4-methoxybenzoyl)amino]thiourea (PubChem CID 23661275) has the molecular formula C29H28N4O4S2 and a molecular weight of 560.70 g/mol. Its IUPAC name is 1-[4-(dibenzylsulfamoyl)phenyl]-3-[(4-methoxybenzoyl)amino]thiourea.
| Compound Name | 1-[4-(dibenzylsulfamoyl)phenyl]-3-[(4-methoxybenzoyl)amino]thiourea |
|---|---|
| PubChem CID | 23661275 |
| Molecular Formula | C29H28N4O4S2 |
| Molecular Weight | 560.70 g/mol |
| Exact Mass | 560.16 |
| IUPAC Name | 1-[4-(dibenzylsulfamoyl)phenyl]-3-[(4-methoxybenzoyl)amino]thiourea |
| SMILES | COc1ccc(C(=O)NNC(=S)Nc2ccc(S(=O)(=O)N(Cc3ccccc3)Cc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C29H28N4O4S2/c1-37-26-16-12-24(13-17-26)28(34)31-32-29(38)30-25-14-18-27(19-15-25)39(35,36)33(20-22-8-4-2-5-9-22)21-23-10-6-3-7-11-23/h2-19H,20-21H2,1H3,(H,31,34)(H2,30,32,38) |
| InChIKey | SQLKXKHJOHDUNP-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.70 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|