C28H26N4O3S2 — CID 23661274
1-benzamido-3-[4-(dibenzylsulfamoyl)phenyl]thiourea (PubChem CID 23661274) has the molecular formula C28H26N4O3S2 and a molecular weight of 530.68 g/mol. Its IUPAC name is 1-benzamido-3-[4-(dibenzylsulfamoyl)phenyl]thiourea.
| Compound Name | 1-benzamido-3-[4-(dibenzylsulfamoyl)phenyl]thiourea |
|---|---|
| PubChem CID | 23661274 |
| Molecular Formula | C28H26N4O3S2 |
| Molecular Weight | 530.68 g/mol |
| Exact Mass | 530.14 |
| IUPAC Name | 1-benzamido-3-[4-(dibenzylsulfamoyl)phenyl]thiourea |
| SMILES | O=C(NNC(=S)Nc1ccc(S(=O)(=O)N(Cc2ccccc2)Cc2ccccc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C28H26N4O3S2/c33-27(24-14-8-3-9-15-24)30-31-28(36)29-25-16-18-26(19-17-25)37(34,35)32(20-22-10-4-1-5-11-22)21-23-12-6-2-7-13-23/h1-19H,20-21H2,(H,30,33)(H2,29,31,36) |
| InChIKey | TUYLDPCZEPKHBR-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.68 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|