C21H18FN2O4S- — CID 20967378
4-[[benzenesulfonyl-[(4-fluorophenyl)methyl]amino]methyl]-N-oxidobenzamide (PubChem CID 20967378) has the molecular formula C21H18FN2O4S- and a molecular weight of 413.45 g/mol. Its IUPAC name is 4-[[benzenesulfonyl-[(4-fluorophenyl)methyl]amino]methyl]-N-oxidobenzamide.
| Compound Name | 4-[[benzenesulfonyl-[(4-fluorophenyl)methyl]amino]methyl]-N-oxidobenzamide |
|---|---|
| PubChem CID | 20967378 |
| Molecular Formula | C21H18FN2O4S- |
| Molecular Weight | 413.45 g/mol |
| Exact Mass | 413.10 |
| IUPAC Name | 4-[[benzenesulfonyl-[(4-fluorophenyl)methyl]amino]methyl]-N-oxidobenzamide |
| SMILES | O=C(N[O-])c1ccc(CN(Cc2ccc(F)cc2)S(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C21H18FN2O4S/c22-19-12-8-17(9-13-19)15-24(29(27,28)20-4-2-1-3-5-20)14-16-6-10-18(11-7-16)21(25)23-26/h1-13H,14-15H2,(H-,23,25,26)/q-1 |
| InChIKey | ZKJJKWXTNGLSDI-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.45 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|