C27H23FN2O3S — CID 92679889
4-[[N-(benzenesulfonyl)anilino]methyl]-N-[(4-fluorophenyl)methyl]benzamide (PubChem CID 92679889) has the molecular formula C27H23FN2O3S and a molecular weight of 474.56 g/mol. Its IUPAC name is 4-[[N-(benzenesulfonyl)anilino]methyl]-N-[(4-fluorophenyl)methyl]benzamide.
| Compound Name | 4-[[N-(benzenesulfonyl)anilino]methyl]-N-[(4-fluorophenyl)methyl]benzamide |
|---|---|
| PubChem CID | 92679889 |
| Molecular Formula | C27H23FN2O3S |
| Molecular Weight | 474.56 g/mol |
| Exact Mass | 474.14 |
| IUPAC Name | 4-[[N-(benzenesulfonyl)anilino]methyl]-N-[(4-fluorophenyl)methyl]benzamide |
| SMILES | O=C(NCc1ccc(F)cc1)c1ccc(CN(c2ccccc2)S(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C27H23FN2O3S/c28-24-17-13-21(14-18-24)19-29-27(31)23-15-11-22(12-16-23)20-30(25-7-3-1-4-8-25)34(32,33)26-9-5-2-6-10-26/h1-18H,19-20H2,(H,29,31) |
| InChIKey | ZGGWCVXTTJSVPZ-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.56 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |