C20H16FNO4S — CID 67529306
4-[benzenesulfonyl-[(4-fluorophenyl)methyl]amino]benzoic acid (PubChem CID 67529306) has the molecular formula C20H16FNO4S and a molecular weight of 385.42 g/mol. Its IUPAC name is 4-[benzenesulfonyl-[(4-fluorophenyl)methyl]amino]benzoic acid.
| Compound Name | 4-[benzenesulfonyl-[(4-fluorophenyl)methyl]amino]benzoic acid |
|---|---|
| PubChem CID | 67529306 |
| Molecular Formula | C20H16FNO4S |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.08 |
| IUPAC Name | 4-[benzenesulfonyl-[(4-fluorophenyl)methyl]amino]benzoic acid |
| SMILES | O=C(O)c1ccc(N(Cc2ccc(F)cc2)S(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C20H16FNO4S/c21-17-10-6-15(7-11-17)14-22(18-12-8-16(9-13-18)20(23)24)27(25,26)19-4-2-1-3-5-19/h1-13H,14H2,(H,23,24) |
| InChIKey | LWASOYRZJYQYCV-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |