C15H12FNO6S — CID 50894343
4-[carboxymethyl-(4-fluorophenyl)sulfonylamino]benzoic acid (PubChem CID 50894343) has the molecular formula C15H12FNO6S and a molecular weight of 353.33 g/mol. Its IUPAC name is 4-[carboxymethyl-(4-fluorophenyl)sulfonylamino]benzoic acid.
| Compound Name | 4-[carboxymethyl-(4-fluorophenyl)sulfonylamino]benzoic acid |
|---|---|
| PubChem CID | 50894343 |
| Molecular Formula | C15H12FNO6S |
| Molecular Weight | 353.33 g/mol |
| Exact Mass | 353.04 |
| IUPAC Name | 4-[carboxymethyl-(4-fluorophenyl)sulfonylamino]benzoic acid |
| SMILES | O=C(O)CN(c1ccc(C(=O)O)cc1)S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C15H12FNO6S/c16-11-3-7-13(8-4-11)24(22,23)17(9-14(18)19)12-5-1-10(2-6-12)15(20)21/h1-8H,9H2,(H,18,19)(H,20,21) |
| InChIKey | SVJWEZYMMBXGFB-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 111.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.33 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |