C16H15BrFNO4S — CID 50890725
4-(4-bromo-N-(4-fluorophenyl)sulfonylanilino)butanoic acid (PubChem CID 50890725) has the molecular formula C16H15BrFNO4S and a molecular weight of 416.27 g/mol. Its IUPAC name is 4-(4-bromo-N-(4-fluorophenyl)sulfonylanilino)butanoic acid.
| Compound Name | 4-(4-bromo-N-(4-fluorophenyl)sulfonylanilino)butanoic acid |
|---|---|
| PubChem CID | 50890725 |
| Molecular Formula | C16H15BrFNO4S |
| Molecular Weight | 416.27 g/mol |
| Exact Mass | 414.99 |
| IUPAC Name | 4-(4-bromo-N-(4-fluorophenyl)sulfonylanilino)butanoic acid |
| SMILES | O=C(O)CCCN(c1ccc(Br)cc1)S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C16H15BrFNO4S/c17-12-3-7-14(8-4-12)19(11-1-2-16(20)21)24(22,23)15-9-5-13(18)6-10-15/h3-10H,1-2,11H2,(H,20,21) |
| InChIKey | BQSBYBQSYIMTJB-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.27 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |