C19H23NO4S — CID 58978369
2-(N-(4-tert-butylphenyl)sulfonyl-4-methylanilino)acetic acid (PubChem CID 58978369) has the molecular formula C19H23NO4S and a molecular weight of 361.46 g/mol. Its IUPAC name is 2-(N-(4-tert-butylphenyl)sulfonyl-4-methylanilino)acetic acid.
| Compound Name | 2-(N-(4-tert-butylphenyl)sulfonyl-4-methylanilino)acetic acid |
|---|---|
| PubChem CID | 58978369 |
| Molecular Formula | C19H23NO4S |
| Molecular Weight | 361.46 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | 2-(N-(4-tert-butylphenyl)sulfonyl-4-methylanilino)acetic acid |
| SMILES | Cc1ccc(N(CC(=O)O)S(=O)(=O)c2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C19H23NO4S/c1-14-5-9-16(10-6-14)20(13-18(21)22)25(23,24)17-11-7-15(8-12-17)19(2,3)4/h5-12H,13H2,1-4H3,(H,21,22) |
| InChIKey | GGXXSNYPUHOKJX-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.46 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |