C29H33N3O3S — CID 58978395
N-benzyl-2-(N-(4-tert-butylphenyl)sulfonyl-4-methylanilino)-N-(2-cyanoethyl)acetamide (PubChem CID 58978395) has the molecular formula C29H33N3O3S and a molecular weight of 503.67 g/mol. Its IUPAC name is N-benzyl-2-(N-(4-tert-butylphenyl)sulfonyl-4-methylanilino)-N-(2-cyanoethyl)acetamide.
| Compound Name | N-benzyl-2-(N-(4-tert-butylphenyl)sulfonyl-4-methylanilino)-N-(2-cyanoethyl)acetamide |
|---|---|
| PubChem CID | 58978395 |
| Molecular Formula | C29H33N3O3S |
| Molecular Weight | 503.67 g/mol |
| Exact Mass | 503.22 |
| IUPAC Name | N-benzyl-2-(N-(4-tert-butylphenyl)sulfonyl-4-methylanilino)-N-(2-cyanoethyl)acetamide |
| SMILES | Cc1ccc(N(CC(=O)N(CCC#N)Cc2ccccc2)S(=O)(=O)c2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C29H33N3O3S/c1-23-11-15-26(16-12-23)32(36(34,35)27-17-13-25(14-18-27)29(2,3)4)22-28(33)31(20-8-19-30)21-24-9-6-5-7-10-24/h5-7,9-18H,8,20-22H2,1-4H3 |
| InChIKey | IOOHPGFBOHMIAQ-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 81.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.67 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |