C20H18FNO2S — CID 35766204
N-benzyl-N-(4-fluorophenyl)-4-methylbenzenesulfonamide (PubChem CID 35766204) has the molecular formula C20H18FNO2S and a molecular weight of 355.43 g/mol. Its IUPAC name is N-benzyl-N-(4-fluorophenyl)-4-methylbenzenesulfonamide.
| Compound Name | N-benzyl-N-(4-fluorophenyl)-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 35766204 |
| Molecular Formula | C20H18FNO2S |
| Molecular Weight | 355.43 g/mol |
| Exact Mass | 355.10 |
| IUPAC Name | N-benzyl-N-(4-fluorophenyl)-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N(Cc2ccccc2)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C20H18FNO2S/c1-16-7-13-20(14-8-16)25(23,24)22(15-17-5-3-2-4-6-17)19-11-9-18(21)10-12-19/h2-14H,15H2,1H3 |
| InChIKey | PEYJIBBZRRMUPV-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.43 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |