C21H20ClNO2S — CID 3959248
N-[(4-chlorophenyl)methyl]-4-methyl-N-(4-methylphenyl)benzenesulfonamide (PubChem CID 3959248) has the molecular formula C21H20ClNO2S and a molecular weight of 385.92 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-4-methyl-N-(4-methylphenyl)benzenesulfonamide.
| Compound Name | N-[(4-chlorophenyl)methyl]-4-methyl-N-(4-methylphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 3959248 |
| Molecular Formula | C21H20ClNO2S |
| Molecular Weight | 385.92 g/mol |
| Exact Mass | 385.09 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-4-methyl-N-(4-methylphenyl)benzenesulfonamide |
| SMILES | Cc1ccc(N(Cc2ccc(Cl)cc2)S(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C21H20ClNO2S/c1-16-3-11-20(12-4-16)23(15-18-7-9-19(22)10-8-18)26(24,25)21-13-5-17(2)6-14-21/h3-14H,15H2,1-2H3 |
| InChIKey | TZKOJTYKHBJVFS-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.92 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |