C26H23NO2S — CID 162402411
N-benzyl-4-methyl-N-(4-phenylphenyl)benzenesulfonamide (PubChem CID 162402411) has the molecular formula C26H23NO2S and a molecular weight of 413.54 g/mol. Its IUPAC name is N-benzyl-4-methyl-N-(4-phenylphenyl)benzenesulfonamide.
| Compound Name | N-benzyl-4-methyl-N-(4-phenylphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 162402411 |
| Molecular Formula | C26H23NO2S |
| Molecular Weight | 413.54 g/mol |
| Exact Mass | 413.14 |
| IUPAC Name | N-benzyl-4-methyl-N-(4-phenylphenyl)benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N(Cc2ccccc2)c2ccc(-c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C26H23NO2S/c1-21-12-18-26(19-13-21)30(28,29)27(20-22-8-4-2-5-9-22)25-16-14-24(15-17-25)23-10-6-3-7-11-23/h2-19H,20H2,1H3 |
| InChIKey | SSPTZKKYQJASMY-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.54 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |