C30H32N2O3S — CID 2884140
N-[3-(dibenzylamino)-2-hydroxypropyl]-N-(4-methylphenyl)benzenesulfonamide (PubChem CID 2884140) has the molecular formula C30H32N2O3S and a molecular weight of 500.66 g/mol. Its IUPAC name is N-[3-(dibenzylamino)-2-hydroxypropyl]-N-(4-methylphenyl)benzenesulfonamide.
| Compound Name | N-[3-(dibenzylamino)-2-hydroxypropyl]-N-(4-methylphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 2884140 |
| Molecular Formula | C30H32N2O3S |
| Molecular Weight | 500.66 g/mol |
| Exact Mass | 500.21 |
| IUPAC Name | N-[3-(dibenzylamino)-2-hydroxypropyl]-N-(4-methylphenyl)benzenesulfonamide |
| SMILES | Cc1ccc(N(CC(O)CN(Cc2ccccc2)Cc2ccccc2)S(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C30H32N2O3S/c1-25-17-19-28(20-18-25)32(36(34,35)30-15-9-4-10-16-30)24-29(33)23-31(21-26-11-5-2-6-12-26)22-27-13-7-3-8-14-27/h2-20,29,33H,21-24H2,1H3 |
| InChIKey | IKCFXCYNCXZCAW-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.66 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |