C31H34N2O4S — CID 2884976
N-[3-(dibenzylamino)-2-hydroxypropyl]-N-(4-methoxyphenyl)-4-methylbenzenesulfonamide (PubChem CID 2884976) has the molecular formula C31H34N2O4S and a molecular weight of 530.69 g/mol. Its IUPAC name is N-[3-(dibenzylamino)-2-hydroxypropyl]-N-(4-methoxyphenyl)-4-methylbenzenesulfonamide.
| Compound Name | N-[3-(dibenzylamino)-2-hydroxypropyl]-N-(4-methoxyphenyl)-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 2884976 |
| Molecular Formula | C31H34N2O4S |
| Molecular Weight | 530.69 g/mol |
| Exact Mass | 530.22 |
| IUPAC Name | N-[3-(dibenzylamino)-2-hydroxypropyl]-N-(4-methoxyphenyl)-4-methylbenzenesulfonamide |
| SMILES | COc1ccc(N(CC(O)CN(Cc2ccccc2)Cc2ccccc2)S(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C31H34N2O4S/c1-25-13-19-31(20-14-25)38(35,36)33(28-15-17-30(37-2)18-16-28)24-29(34)23-32(21-26-9-5-3-6-10-26)22-27-11-7-4-8-12-27/h3-20,29,34H,21-24H2,1-2H3 |
| InChIKey | YSLRPKZZQWXJGE-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.69 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |