C21H29N2O4S+ — CID 6963649
N-[(2S)-2-hydroxy-3-piperidin-1-ium-1-ylpropyl]-N-(4-methoxyphenyl)benzenesulfonamide (PubChem CID 6963649) has the molecular formula C21H29N2O4S+ and a molecular weight of 405.54 g/mol. Its IUPAC name is N-[(2S)-2-hydroxy-3-piperidin-1-ium-1-ylpropyl]-N-(4-methoxyphenyl)benzenesulfonamide.
| Compound Name | N-[(2S)-2-hydroxy-3-piperidin-1-ium-1-ylpropyl]-N-(4-methoxyphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 6963649 |
| Molecular Formula | C21H29N2O4S+ |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.18 |
| IUPAC Name | N-[(2S)-2-hydroxy-3-piperidin-1-ium-1-ylpropyl]-N-(4-methoxyphenyl)benzenesulfonamide |
| SMILES | COc1ccc(N(C[C@@H](O)C[NH+]2CCCCC2)S(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C21H28N2O4S/c1-27-20-12-10-18(11-13-20)23(28(25,26)21-8-4-2-5-9-21)17-19(24)16-22-14-6-3-7-15-22/h2,4-5,8-13,19,24H,3,6-7,14-17H2,1H3/p+1/t19-/m0/s1 |
| InChIKey | GWYAIDQEXHNEOY-IBGZPJMESA-O |
| XLogP | 1.32 |
| TPSA | 71.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |