C22H30N2O4S — CID 1077010
N-[(2S)-2-hydroxy-3-(4-methylpiperidin-1-yl)propyl]-N-(4-methoxyphenyl)benzenesulfonamide (PubChem CID 1077010) has the molecular formula C22H30N2O4S and a molecular weight of 418.56 g/mol. Its IUPAC name is N-[(2S)-2-hydroxy-3-(4-methylpiperidin-1-yl)propyl]-N-(4-methoxyphenyl)benzenesulfonamide.
| Compound Name | N-[(2S)-2-hydroxy-3-(4-methylpiperidin-1-yl)propyl]-N-(4-methoxyphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 1077010 |
| Molecular Formula | C22H30N2O4S |
| Molecular Weight | 418.56 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | N-[(2S)-2-hydroxy-3-(4-methylpiperidin-1-yl)propyl]-N-(4-methoxyphenyl)benzenesulfonamide |
| SMILES | COc1ccc(N(C[C@@H](O)CN2CCC(C)CC2)S(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C22H30N2O4S/c1-18-12-14-23(15-13-18)16-20(25)17-24(19-8-10-21(28-2)11-9-19)29(26,27)22-6-4-3-5-7-22/h3-11,18,20,25H,12-17H2,1-2H3/t20-/m0/s1 |
| InChIKey | HEBARYKBIJUVBR-FQEVSTJZSA-N |
| XLogP | 2.98 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.56 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |