C21H29N2O3S+ — CID 1415907
N-[(2R)-2-hydroxy-3-piperidin-1-ium-1-ylpropyl]-N-(4-methylphenyl)benzenesulfonamide (PubChem CID 1415907) has the molecular formula C21H29N2O3S+ and a molecular weight of 389.54 g/mol. Its IUPAC name is N-[(2R)-2-hydroxy-3-piperidin-1-ium-1-ylpropyl]-N-(4-methylphenyl)benzenesulfonamide.
| Compound Name | N-[(2R)-2-hydroxy-3-piperidin-1-ium-1-ylpropyl]-N-(4-methylphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 1415907 |
| Molecular Formula | C21H29N2O3S+ |
| Molecular Weight | 389.54 g/mol |
| Exact Mass | 389.19 |
| IUPAC Name | N-[(2R)-2-hydroxy-3-piperidin-1-ium-1-ylpropyl]-N-(4-methylphenyl)benzenesulfonamide |
| SMILES | Cc1ccc(N(C[C@H](O)C[NH+]2CCCCC2)S(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C21H28N2O3S/c1-18-10-12-19(13-11-18)23(27(25,26)21-8-4-2-5-9-21)17-20(24)16-22-14-6-3-7-15-22/h2,4-5,8-13,20,24H,3,6-7,14-17H2,1H3/p+1/t20-/m1/s1 |
| InChIKey | WOSBWXMYRPCZJL-HXUWFJFHSA-O |
| XLogP | 1.62 |
| TPSA | 62.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.54 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |