C20H27N2O4S+ — CID 7429800
N-[(2R)-2-hydroxy-3-morpholin-4-ium-4-ylpropyl]-4-methyl-N-phenylbenzenesulfonamide (PubChem CID 7429800) has the molecular formula C20H27N2O4S+ and a molecular weight of 391.51 g/mol. Its IUPAC name is N-[(2R)-2-hydroxy-3-morpholin-4-ium-4-ylpropyl]-4-methyl-N-phenylbenzenesulfonamide.
| Compound Name | N-[(2R)-2-hydroxy-3-morpholin-4-ium-4-ylpropyl]-4-methyl-N-phenylbenzenesulfonamide |
|---|---|
| PubChem CID | 7429800 |
| Molecular Formula | C20H27N2O4S+ |
| Molecular Weight | 391.51 g/mol |
| Exact Mass | 391.17 |
| IUPAC Name | N-[(2R)-2-hydroxy-3-morpholin-4-ium-4-ylpropyl]-4-methyl-N-phenylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N(C[C@H](O)C[NH+]2CCOCC2)c2ccccc2)cc1 |
| InChI | InChI=1S/C20H26N2O4S/c1-17-7-9-20(10-8-17)27(24,25)22(18-5-3-2-4-6-18)16-19(23)15-21-11-13-26-14-12-21/h2-10,19,23H,11-16H2,1H3/p+1/t19-/m1/s1 |
| InChIKey | FEWYKEJFXYNDKY-LJQANCHMSA-O |
| XLogP | 0.47 |
| TPSA | 71.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.51 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |