C19H24N3O6S+ — CID 7429809
N-[(2S)-2-hydroxy-3-morpholin-4-ium-4-ylpropyl]-N-(2-nitrophenyl)benzenesulfonamide (PubChem CID 7429809) has the molecular formula C19H24N3O6S+ and a molecular weight of 422.48 g/mol. Its IUPAC name is N-[(2S)-2-hydroxy-3-morpholin-4-ium-4-ylpropyl]-N-(2-nitrophenyl)benzenesulfonamide.
| Compound Name | N-[(2S)-2-hydroxy-3-morpholin-4-ium-4-ylpropyl]-N-(2-nitrophenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 7429809 |
| Molecular Formula | C19H24N3O6S+ |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.14 |
| IUPAC Name | N-[(2S)-2-hydroxy-3-morpholin-4-ium-4-ylpropyl]-N-(2-nitrophenyl)benzenesulfonamide |
| SMILES | O=[N+]([O-])c1ccccc1N(C[C@@H](O)C[NH+]1CCOCC1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C19H23N3O6S/c23-16(14-20-10-12-28-13-11-20)15-21(18-8-4-5-9-19(18)22(24)25)29(26,27)17-6-2-1-3-7-17/h1-9,16,23H,10-15H2/p+1/t16-/m0/s1 |
| InChIKey | DMWNKPHJXKKLSB-INIZCTEOSA-O |
| XLogP | 0.07 |
| TPSA | 114.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|