C20H27N2O3S+ — CID 1420558
N-[(2R)-2-hydroxy-3-pyrrolidin-1-ium-1-ylpropyl]-N-(4-methylphenyl)benzenesulfonamide (PubChem CID 1420558) has the molecular formula C20H27N2O3S+ and a molecular weight of 375.51 g/mol. Its IUPAC name is N-[(2R)-2-hydroxy-3-pyrrolidin-1-ium-1-ylpropyl]-N-(4-methylphenyl)benzenesulfonamide.
| Compound Name | N-[(2R)-2-hydroxy-3-pyrrolidin-1-ium-1-ylpropyl]-N-(4-methylphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 1420558 |
| Molecular Formula | C20H27N2O3S+ |
| Molecular Weight | 375.51 g/mol |
| Exact Mass | 375.17 |
| IUPAC Name | N-[(2R)-2-hydroxy-3-pyrrolidin-1-ium-1-ylpropyl]-N-(4-methylphenyl)benzenesulfonamide |
| SMILES | Cc1ccc(N(C[C@H](O)C[NH+]2CCCC2)S(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C20H26N2O3S/c1-17-9-11-18(12-10-17)22(16-19(23)15-21-13-5-6-14-21)26(24,25)20-7-3-2-4-8-20/h2-4,7-12,19,23H,5-6,13-16H2,1H3/p+1/t19-/m1/s1 |
| InChIKey | DJZWPMWOJCHJCS-LJQANCHMSA-O |
| XLogP | 1.23 |
| TPSA | 62.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.51 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |