C18H24ClN2O3S- — CID 53313632
N-[3-(dimethylamino)-2-hydroxypropyl]-N-(4-methylphenyl)benzenesulfonamide chloride (PubChem CID 53313632) has the molecular formula C18H24ClN2O3S- and a molecular weight of 383.92 g/mol. Its IUPAC name is N-[3-(dimethylamino)-2-hydroxypropyl]-N-(4-methylphenyl)benzenesulfonamide chloride.
| Compound Name | N-[3-(dimethylamino)-2-hydroxypropyl]-N-(4-methylphenyl)benzenesulfonamide chloride |
|---|---|
| PubChem CID | 53313632 |
| Molecular Formula | C18H24ClN2O3S- |
| Molecular Weight | 383.92 g/mol |
| Exact Mass | 383.12 |
| IUPAC Name | N-[3-(dimethylamino)-2-hydroxypropyl]-N-(4-methylphenyl)benzenesulfonamide chloride |
| SMILES | Cc1ccc(N(CC(O)CN(C)C)S(=O)(=O)c2ccccc2)cc1.[Cl-] |
| InChI | InChI=1S/C18H24N2O3S.ClH/c1-15-9-11-16(12-10-15)20(14-17(21)13-19(2)3)24(22,23)18-7-5-4-6-8-18;/h4-12,17,21H,13-14H2,1-3H3;1H/p-1 |
| InChIKey | PDMGPUIUTBWLHA-UHFFFAOYSA-M |
| XLogP | -0.88 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.92 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |