C23H35N2O4S+ — CID 4279292
[2-hydroxy-3-(4-methoxy-N-(4-methylphenyl)sulfonylanilino)propyl]-dipropylazanium (PubChem CID 4279292) has the molecular formula C23H35N2O4S+ and a molecular weight of 435.61 g/mol. Its IUPAC name is [2-hydroxy-3-(4-methoxy-N-(4-methylphenyl)sulfonylanilino)propyl]-dipropylazanium.
| Compound Name | [2-hydroxy-3-(4-methoxy-N-(4-methylphenyl)sulfonylanilino)propyl]-dipropylazanium |
|---|---|
| PubChem CID | 4279292 |
| Molecular Formula | C23H35N2O4S+ |
| Molecular Weight | 435.61 g/mol |
| Exact Mass | 435.23 |
| IUPAC Name | [2-hydroxy-3-(4-methoxy-N-(4-methylphenyl)sulfonylanilino)propyl]-dipropylazanium |
| SMILES | CCC[NH+](CCC)CC(O)CN(c1ccc(OC)cc1)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C23H34N2O4S/c1-5-15-24(16-6-2)17-21(26)18-25(20-9-11-22(29-4)12-10-20)30(27,28)23-13-7-19(3)8-14-23/h7-14,21,26H,5-6,15-18H2,1-4H3/p+1 |
| InChIKey | RBVGIWQKWDJXNW-UHFFFAOYSA-O |
| XLogP | 2.26 |
| TPSA | 71.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.61 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |