C25H39ClN2O3S — CID 44659116
dibutyl-[2-hydroxy-3-(4-methyl-N-(4-methylphenyl)sulfonylanilino)propyl]azanium chloride (PubChem CID 44659116) has the molecular formula C25H39ClN2O3S and a molecular weight of 483.12 g/mol. Its IUPAC name is dibutyl-[2-hydroxy-3-(4-methyl-N-(4-methylphenyl)sulfonylanilino)propyl]azanium chloride.
| Compound Name | dibutyl-[2-hydroxy-3-(4-methyl-N-(4-methylphenyl)sulfonylanilino)propyl]azanium chloride |
|---|---|
| PubChem CID | 44659116 |
| Molecular Formula | C25H39ClN2O3S |
| Molecular Weight | 483.12 g/mol |
| Exact Mass | 482.24 |
| IUPAC Name | dibutyl-[2-hydroxy-3-(4-methyl-N-(4-methylphenyl)sulfonylanilino)propyl]azanium chloride |
| SMILES | CCCC[NH+](CCCC)CC(O)CN(c1ccc(C)cc1)S(=O)(=O)c1ccc(C)cc1.[Cl-] |
| InChI | InChI=1S/C25H38N2O3S.ClH/c1-5-7-17-26(18-8-6-2)19-24(28)20-27(23-13-9-21(3)10-14-23)31(29,30)25-15-11-22(4)12-16-25;/h9-16,24,28H,5-8,17-20H2,1-4H3;1H |
| InChIKey | KDWLRSZGUBDNTD-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 62.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.12 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |