C29H25BrN2O4S — CID 94850901
N-(4-bromophenyl)-N-[(2S)-3-(fluoren-9-ylideneamino)oxy-2-hydroxypropyl]-4-methylbenzenesulfonamide (PubChem CID 94850901) has the molecular formula C29H25BrN2O4S and a molecular weight of 577.50 g/mol. Its IUPAC name is N-(4-bromophenyl)-N-[(2S)-3-(fluoren-9-ylideneamino)oxy-2-hydroxypropyl]-4-methylbenzenesulfonamide.
| Compound Name | N-(4-bromophenyl)-N-[(2S)-3-(fluoren-9-ylideneamino)oxy-2-hydroxypropyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 94850901 |
| Molecular Formula | C29H25BrN2O4S |
| Molecular Weight | 577.50 g/mol |
| Exact Mass | 576.07 |
| IUPAC Name | N-(4-bromophenyl)-N-[(2S)-3-(fluoren-9-ylideneamino)oxy-2-hydroxypropyl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N(C[C@H](O)CON=C2c3ccccc3-c3ccccc32)c2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C29H25BrN2O4S/c1-20-10-16-24(17-11-20)37(34,35)32(22-14-12-21(30)13-15-22)18-23(33)19-36-31-29-27-8-4-2-6-25(27)26-7-3-5-9-28(26)29/h2-17,23,33H,18-19H2,1H3/t23-/m0/s1 |
| InChIKey | DMBAIIUHLKDYNT-QHCPKHFHSA-N |
| XLogP | 5.76 |
| TPSA | 79.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.50 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|