C23H21BrN2O4S — CID 12005976
4-bromo-N-[3-(fluoren-9-ylideneamino)oxy-2-hydroxypropyl]-N-methylbenzenesulfonamide (PubChem CID 12005976) has the molecular formula C23H21BrN2O4S and a molecular weight of 501.40 g/mol. Its IUPAC name is 4-bromo-N-[3-(fluoren-9-ylideneamino)oxy-2-hydroxypropyl]-N-methylbenzenesulfonamide.
| Compound Name | 4-bromo-N-[3-(fluoren-9-ylideneamino)oxy-2-hydroxypropyl]-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 12005976 |
| Molecular Formula | C23H21BrN2O4S |
| Molecular Weight | 501.40 g/mol |
| Exact Mass | 500.04 |
| IUPAC Name | 4-bromo-N-[3-(fluoren-9-ylideneamino)oxy-2-hydroxypropyl]-N-methylbenzenesulfonamide |
| SMILES | CN(CC(O)CON=C1c2ccccc2-c2ccccc21)S(=O)(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C23H21BrN2O4S/c1-26(31(28,29)18-12-10-16(24)11-13-18)14-17(27)15-30-25-23-21-8-4-2-6-19(21)20-7-3-5-9-22(20)23/h2-13,17,27H,14-15H2,1H3 |
| InChIKey | UZYMIKGSXDGGFC-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 79.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.40 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|