C20H27NO4S — CID 41244864
N-[(2R)-3-(4-tert-butylphenoxy)-2-hydroxypropyl]-N-methylbenzenesulfonamide (PubChem CID 41244864) has the molecular formula C20H27NO4S and a molecular weight of 377.51 g/mol. Its IUPAC name is N-[(2R)-3-(4-tert-butylphenoxy)-2-hydroxypropyl]-N-methylbenzenesulfonamide.
| Compound Name | N-[(2R)-3-(4-tert-butylphenoxy)-2-hydroxypropyl]-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 41244864 |
| Molecular Formula | C20H27NO4S |
| Molecular Weight | 377.51 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | N-[(2R)-3-(4-tert-butylphenoxy)-2-hydroxypropyl]-N-methylbenzenesulfonamide |
| SMILES | CN(C[C@@H](O)COc1ccc(C(C)(C)C)cc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C20H27NO4S/c1-20(2,3)16-10-12-18(13-11-16)25-15-17(22)14-21(4)26(23,24)19-8-6-5-7-9-19/h5-13,17,22H,14-15H2,1-4H3/t17-/m1/s1 |
| InChIKey | VVWSHCCYPQAMLC-QGZVFWFLSA-N |
| XLogP | 3.04 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.51 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |