C12H19NO5S — CID 81258385
N-(2-hydroxy-3-methoxypropyl)-3-methoxy-N-methylbenzenesulfonamide (PubChem CID 81258385) has the molecular formula C12H19NO5S and a molecular weight of 289.35 g/mol. Its IUPAC name is N-(2-hydroxy-3-methoxypropyl)-3-methoxy-N-methylbenzenesulfonamide.
| Compound Name | N-(2-hydroxy-3-methoxypropyl)-3-methoxy-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 81258385 |
| Molecular Formula | C12H19NO5S |
| Molecular Weight | 289.35 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | N-(2-hydroxy-3-methoxypropyl)-3-methoxy-N-methylbenzenesulfonamide |
| SMILES | COCC(O)CN(C)S(=O)(=O)c1cccc(OC)c1 |
| InChI | InChI=1S/C12H19NO5S/c1-13(8-10(14)9-17-2)19(15,16)12-6-4-5-11(7-12)18-3/h4-7,10,14H,8-9H2,1-3H3 |
| InChIKey | NHTJUQLFNMIZLR-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.35 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |