C11H16NO6S- — CID 3706704
N-[2-hydroxy-3-(3-methoxyphenoxy)propyl]-N-methylsulfamate (PubChem CID 3706704) has the molecular formula C11H16NO6S- and a molecular weight of 290.32 g/mol. Its IUPAC name is N-[2-hydroxy-3-(3-methoxyphenoxy)propyl]-N-methylsulfamate.
| Compound Name | N-[2-hydroxy-3-(3-methoxyphenoxy)propyl]-N-methylsulfamate |
|---|---|
| PubChem CID | 3706704 |
| Molecular Formula | C11H16NO6S- |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.07 |
| IUPAC Name | N-[2-hydroxy-3-(3-methoxyphenoxy)propyl]-N-methylsulfamate |
| SMILES | COc1cccc(OCC(O)CN(C)S(=O)(=O)[O-])c1 |
| InChI | InChI=1S/C11H17NO6S/c1-12(19(14,15)16)7-9(13)8-18-11-5-3-4-10(6-11)17-2/h3-6,9,13H,7-8H2,1-2H3,(H,14,15,16)/p-1 |
| InChIKey | QSXOTNWHAHAJQE-UHFFFAOYSA-M |
| XLogP | -0.17 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|