C14H23NO5S — CID 64642037
1-(3-methoxyphenoxy)-3-(1-methylsulfonylpropan-2-ylamino)propan-2-ol (PubChem CID 64642037) has the molecular formula C14H23NO5S and a molecular weight of 317.41 g/mol. Its IUPAC name is 1-(3-methoxyphenoxy)-3-(1-methylsulfonylpropan-2-ylamino)propan-2-ol.
| Compound Name | 1-(3-methoxyphenoxy)-3-(1-methylsulfonylpropan-2-ylamino)propan-2-ol |
|---|---|
| PubChem CID | 64642037 |
| Molecular Formula | C14H23NO5S |
| Molecular Weight | 317.41 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | 1-(3-methoxyphenoxy)-3-(1-methylsulfonylpropan-2-ylamino)propan-2-ol |
| SMILES | COc1cccc(OCC(O)CNC(C)CS(C)(=O)=O)c1 |
| InChI | InChI=1S/C14H23NO5S/c1-11(10-21(3,17)18)15-8-12(16)9-20-14-6-4-5-13(7-14)19-2/h4-7,11-12,15-16H,8-10H2,1-3H3 |
| InChIKey | OTQVBXYUMCQOFY-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.41 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |