C15H25NO5 — CID 106159850
3-[[2-hydroxy-3-(3-methoxyphenoxy)propyl]amino]-4-methoxybutan-1-ol (PubChem CID 106159850) has the molecular formula C15H25NO5 and a molecular weight of 299.37 g/mol. Its IUPAC name is 3-[[2-hydroxy-3-(3-methoxyphenoxy)propyl]amino]-4-methoxybutan-1-ol.
| Compound Name | 3-[[2-hydroxy-3-(3-methoxyphenoxy)propyl]amino]-4-methoxybutan-1-ol |
|---|---|
| PubChem CID | 106159850 |
| Molecular Formula | C15H25NO5 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.17 |
| IUPAC Name | 3-[[2-hydroxy-3-(3-methoxyphenoxy)propyl]amino]-4-methoxybutan-1-ol |
| SMILES | COCC(CCO)NCC(O)COc1cccc(OC)c1 |
| InChI | InChI=1S/C15H25NO5/c1-19-10-12(6-7-17)16-9-13(18)11-21-15-5-3-4-14(8-15)20-2/h3-5,8,12-13,16-18H,6-7,9-11H2,1-2H3 |
| InChIKey | VFSAYNICQZNLSQ-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 80.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |