C16H21NO4 — CID 60909460
1-[1-(furan-2-yl)ethylamino]-3-(3-methoxyphenoxy)propan-2-ol (PubChem CID 60909460) has the molecular formula C16H21NO4 and a molecular weight of 291.35 g/mol. Its IUPAC name is 1-[1-(furan-2-yl)ethylamino]-3-(3-methoxyphenoxy)propan-2-ol.
| Compound Name | 1-[1-(furan-2-yl)ethylamino]-3-(3-methoxyphenoxy)propan-2-ol |
|---|---|
| PubChem CID | 60909460 |
| Molecular Formula | C16H21NO4 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | 1-[1-(furan-2-yl)ethylamino]-3-(3-methoxyphenoxy)propan-2-ol |
| SMILES | COc1cccc(OCC(O)CNC(C)c2ccco2)c1 |
| InChI | InChI=1S/C16H21NO4/c1-12(16-7-4-8-20-16)17-10-13(18)11-21-15-6-3-5-14(9-15)19-2/h3-9,12-13,17-18H,10-11H2,1-2H3 |
| InChIKey | AGCHZIDYFXLXMM-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 63.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |