C16H21NO3S — CID 62841183
1-(3-methoxyphenoxy)-3-(1-thiophen-3-ylethylamino)propan-2-ol (PubChem CID 62841183) has the molecular formula C16H21NO3S and a molecular weight of 307.42 g/mol. Its IUPAC name is 1-(3-methoxyphenoxy)-3-(1-thiophen-3-ylethylamino)propan-2-ol.
| Compound Name | 1-(3-methoxyphenoxy)-3-(1-thiophen-3-ylethylamino)propan-2-ol |
|---|---|
| PubChem CID | 62841183 |
| Molecular Formula | C16H21NO3S |
| Molecular Weight | 307.42 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | 1-(3-methoxyphenoxy)-3-(1-thiophen-3-ylethylamino)propan-2-ol |
| SMILES | COc1cccc(OCC(O)CNC(C)c2ccsc2)c1 |
| InChI | InChI=1S/C16H21NO3S/c1-12(13-6-7-21-11-13)17-9-14(18)10-20-16-5-3-4-15(8-16)19-2/h3-8,11-12,14,17-18H,9-10H2,1-2H3 |
| InChIKey | BOXAIMOGNUNJFE-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.42 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |