C17H23NO2S — CID 62841185
1-(4-ethylphenoxy)-3-(1-thiophen-3-ylethylamino)propan-2-ol (PubChem CID 62841185) has the molecular formula C17H23NO2S and a molecular weight of 305.44 g/mol. Its IUPAC name is 1-(4-ethylphenoxy)-3-(1-thiophen-3-ylethylamino)propan-2-ol.
| Compound Name | 1-(4-ethylphenoxy)-3-(1-thiophen-3-ylethylamino)propan-2-ol |
|---|---|
| PubChem CID | 62841185 |
| Molecular Formula | C17H23NO2S |
| Molecular Weight | 305.44 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | 1-(4-ethylphenoxy)-3-(1-thiophen-3-ylethylamino)propan-2-ol |
| SMILES | CCc1ccc(OCC(O)CNC(C)c2ccsc2)cc1 |
| InChI | InChI=1S/C17H23NO2S/c1-3-14-4-6-17(7-5-14)20-11-16(19)10-18-13(2)15-8-9-21-12-15/h4-9,12-13,16,18-19H,3,10-11H2,1-2H3 |
| InChIKey | BVBDDHZXGDHTLX-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.44 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |