C22H32ClNO2 — CID 138958832
1-[1-(4-ethylphenyl)ethylamino]-3-(4-propan-2-ylphenoxy)propan-2-ol;hydrochloride (PubChem CID 138958832) has the molecular formula C22H32ClNO2 and a molecular weight of 377.96 g/mol. Its IUPAC name is 1-[1-(4-ethylphenyl)ethylamino]-3-(4-propan-2-ylphenoxy)propan-2-ol;hydrochloride.
| Compound Name | 1-[1-(4-ethylphenyl)ethylamino]-3-(4-propan-2-ylphenoxy)propan-2-ol;hydrochloride |
|---|---|
| PubChem CID | 138958832 |
| Molecular Formula | C22H32ClNO2 |
| Molecular Weight | 377.96 g/mol |
| Exact Mass | 377.21 |
| IUPAC Name | 1-[1-(4-ethylphenyl)ethylamino]-3-(4-propan-2-ylphenoxy)propan-2-ol;hydrochloride |
| SMILES | CCc1ccc(C(C)NCC(O)COc2ccc(C(C)C)cc2)cc1.Cl |
| InChI | InChI=1S/C22H31NO2.ClH/c1-5-18-6-8-20(9-7-18)17(4)23-14-21(24)15-25-22-12-10-19(11-13-22)16(2)3;/h6-13,16-17,21,23-24H,5,14-15H2,1-4H3;1H |
| InChIKey | JQQCERBTFPNQEG-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.96 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |