C18H26ClNO2S — CID 138959117
1-(4-propan-2-ylphenoxy)-3-(1-thiophen-2-ylethylamino)propan-2-ol;hydrochloride (PubChem CID 138959117) has the molecular formula C18H26ClNO2S and a molecular weight of 355.93 g/mol. Its IUPAC name is 1-(4-propan-2-ylphenoxy)-3-(1-thiophen-2-ylethylamino)propan-2-ol;hydrochloride.
| Compound Name | 1-(4-propan-2-ylphenoxy)-3-(1-thiophen-2-ylethylamino)propan-2-ol;hydrochloride |
|---|---|
| PubChem CID | 138959117 |
| Molecular Formula | C18H26ClNO2S |
| Molecular Weight | 355.93 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | 1-(4-propan-2-ylphenoxy)-3-(1-thiophen-2-ylethylamino)propan-2-ol;hydrochloride |
| SMILES | CC(C)c1ccc(OCC(O)CNC(C)c2cccs2)cc1.Cl |
| InChI | InChI=1S/C18H25NO2S.ClH/c1-13(2)15-6-8-17(9-7-15)21-12-16(20)11-19-14(3)18-5-4-10-22-18;/h4-10,13-14,16,19-20H,11-12H2,1-3H3;1H |
| InChIKey | QZUUGVQKGNMPSH-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.93 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |