C15H19ClFNO2S — CID 138959134
1-(2-fluorophenoxy)-3-(1-thiophen-2-ylethylamino)propan-2-ol;hydrochloride (PubChem CID 138959134) has the molecular formula C15H19ClFNO2S and a molecular weight of 331.84 g/mol. Its IUPAC name is 1-(2-fluorophenoxy)-3-(1-thiophen-2-ylethylamino)propan-2-ol;hydrochloride.
| Compound Name | 1-(2-fluorophenoxy)-3-(1-thiophen-2-ylethylamino)propan-2-ol;hydrochloride |
|---|---|
| PubChem CID | 138959134 |
| Molecular Formula | C15H19ClFNO2S |
| Molecular Weight | 331.84 g/mol |
| Exact Mass | 331.08 |
| IUPAC Name | 1-(2-fluorophenoxy)-3-(1-thiophen-2-ylethylamino)propan-2-ol;hydrochloride |
| SMILES | CC(NCC(O)COc1ccccc1F)c1cccs1.Cl |
| InChI | InChI=1S/C15H18FNO2S.ClH/c1-11(15-7-4-8-20-15)17-9-12(18)10-19-14-6-3-2-5-13(14)16;/h2-8,11-12,17-18H,9-10H2,1H3;1H |
| InChIKey | JACTZOZBEAGNPH-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.84 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |