C16H21Cl2NO2S — CID 138959137
1-(4-chloro-2-methylphenoxy)-3-(1-thiophen-2-ylethylamino)propan-2-ol;hydrochloride (PubChem CID 138959137) has the molecular formula C16H21Cl2NO2S and a molecular weight of 362.32 g/mol. Its IUPAC name is 1-(4-chloro-2-methylphenoxy)-3-(1-thiophen-2-ylethylamino)propan-2-ol;hydrochloride.
| Compound Name | 1-(4-chloro-2-methylphenoxy)-3-(1-thiophen-2-ylethylamino)propan-2-ol;hydrochloride |
|---|---|
| PubChem CID | 138959137 |
| Molecular Formula | C16H21Cl2NO2S |
| Molecular Weight | 362.32 g/mol |
| Exact Mass | 361.07 |
| IUPAC Name | 1-(4-chloro-2-methylphenoxy)-3-(1-thiophen-2-ylethylamino)propan-2-ol;hydrochloride |
| SMILES | Cc1cc(Cl)ccc1OCC(O)CNC(C)c1cccs1.Cl |
| InChI | InChI=1S/C16H20ClNO2S.ClH/c1-11-8-13(17)5-6-15(11)20-10-14(19)9-18-12(2)16-4-3-7-21-16;/h3-8,12,14,18-19H,9-10H2,1-2H3;1H |
| InChIKey | ZGOXGEVMKHUXQT-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.32 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |