C20H26ClNO2S — CID 138961023
1-(4-chloro-2-methylphenoxy)-3-[[cyclopentyl(thiophen-2-yl)methyl]amino]propan-2-ol (PubChem CID 138961023) has the molecular formula C20H26ClNO2S and a molecular weight of 379.95 g/mol. Its IUPAC name is 1-(4-chloro-2-methylphenoxy)-3-[[cyclopentyl(thiophen-2-yl)methyl]amino]propan-2-ol.
| Compound Name | 1-(4-chloro-2-methylphenoxy)-3-[[cyclopentyl(thiophen-2-yl)methyl]amino]propan-2-ol |
|---|---|
| PubChem CID | 138961023 |
| Molecular Formula | C20H26ClNO2S |
| Molecular Weight | 379.95 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | 1-(4-chloro-2-methylphenoxy)-3-[[cyclopentyl(thiophen-2-yl)methyl]amino]propan-2-ol |
| SMILES | Cc1cc(Cl)ccc1OCC(O)CNC(c1cccs1)C1CCCC1 |
| InChI | InChI=1S/C20H26ClNO2S/c1-14-11-16(21)8-9-18(14)24-13-17(23)12-22-20(15-5-2-3-6-15)19-7-4-10-25-19/h4,7-11,15,17,20,22-23H,2-3,5-6,12-13H2,1H3 |
| InChIKey | MYFPMDUAEVYHQZ-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.95 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |