C20H27NO3S — CID 138960997
1-[[cyclopentyl(thiophen-2-yl)methyl]amino]-3-(2-methoxyphenoxy)propan-2-ol (PubChem CID 138960997) has the molecular formula C20H27NO3S and a molecular weight of 361.51 g/mol. Its IUPAC name is 1-[[cyclopentyl(thiophen-2-yl)methyl]amino]-3-(2-methoxyphenoxy)propan-2-ol.
| Compound Name | 1-[[cyclopentyl(thiophen-2-yl)methyl]amino]-3-(2-methoxyphenoxy)propan-2-ol |
|---|---|
| PubChem CID | 138960997 |
| Molecular Formula | C20H27NO3S |
| Molecular Weight | 361.51 g/mol |
| Exact Mass | 361.17 |
| IUPAC Name | 1-[[cyclopentyl(thiophen-2-yl)methyl]amino]-3-(2-methoxyphenoxy)propan-2-ol |
| SMILES | COc1ccccc1OCC(O)CNC(c1cccs1)C1CCCC1 |
| InChI | InChI=1S/C20H27NO3S/c1-23-17-9-4-5-10-18(17)24-14-16(22)13-21-20(15-7-2-3-8-15)19-11-6-12-25-19/h4-6,9-12,15-16,20-22H,2-3,7-8,13-14H2,1H3 |
| InChIKey | RHVOVJFUHAGADT-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.51 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |