C15H22O3 — CID 103160603
1-cyclopentyl-3-(2-methoxyphenoxy)propan-2-ol (PubChem CID 103160603) has the molecular formula C15H22O3 and a molecular weight of 250.34 g/mol. Its IUPAC name is 1-cyclopentyl-3-(2-methoxyphenoxy)propan-2-ol.
| Compound Name | 1-cyclopentyl-3-(2-methoxyphenoxy)propan-2-ol |
|---|---|
| PubChem CID | 103160603 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | 1-cyclopentyl-3-(2-methoxyphenoxy)propan-2-ol |
| SMILES | COc1ccccc1OCC(O)CC1CCCC1 |
| InChI | InChI=1S/C15H22O3/c1-17-14-8-4-5-9-15(14)18-11-13(16)10-12-6-2-3-7-12/h4-5,8-9,12-13,16H,2-3,6-7,10-11H2,1H3 |
| InChIKey | QYAKBMZHHBKFIP-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |