C16H23BrO3 — CID 103159097
1-[5-bromo-2-[(1S)-1-hydroxyethyl]phenoxy]-3-cyclopentylpropan-2-ol (PubChem CID 103159097) has the molecular formula C16H23BrO3 and a molecular weight of 343.26 g/mol. Its IUPAC name is 1-[5-bromo-2-[(1S)-1-hydroxyethyl]phenoxy]-3-cyclopentylpropan-2-ol.
| Compound Name | 1-[5-bromo-2-[(1S)-1-hydroxyethyl]phenoxy]-3-cyclopentylpropan-2-ol |
|---|---|
| PubChem CID | 103159097 |
| Molecular Formula | C16H23BrO3 |
| Molecular Weight | 343.26 g/mol |
| Exact Mass | 342.08 |
| IUPAC Name | 1-[5-bromo-2-[(1S)-1-hydroxyethyl]phenoxy]-3-cyclopentylpropan-2-ol |
| SMILES | C[C@H](O)c1ccc(Br)cc1OCC(O)CC1CCCC1 |
| InChI | InChI=1S/C16H23BrO3/c1-11(18)15-7-6-13(17)9-16(15)20-10-14(19)8-12-4-2-3-5-12/h6-7,9,11-12,14,18-19H,2-5,8,10H2,1H3/t11-,14?/m0/s1 |
| InChIKey | NXVSJQKTIXALPE-ZSOXZCCMSA-N |
| XLogP | 3.82 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.26 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |