C16H23BrO2 — CID 102948860
(1R)-1-[4-bromo-2-(2-ethylcyclohexyl)oxyphenyl]ethanol (PubChem CID 102948860) has the molecular formula C16H23BrO2 and a molecular weight of 327.26 g/mol. Its IUPAC name is (1R)-1-[4-bromo-2-(2-ethylcyclohexyl)oxyphenyl]ethanol.
| Compound Name | (1R)-1-[4-bromo-2-(2-ethylcyclohexyl)oxyphenyl]ethanol |
|---|---|
| PubChem CID | 102948860 |
| Molecular Formula | C16H23BrO2 |
| Molecular Weight | 327.26 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | (1R)-1-[4-bromo-2-(2-ethylcyclohexyl)oxyphenyl]ethanol |
| SMILES | CCC1CCCCC1Oc1cc(Br)ccc1[C@@H](C)O |
| InChI | InChI=1S/C16H23BrO2/c1-3-12-6-4-5-7-15(12)19-16-10-13(17)8-9-14(16)11(2)18/h8-12,15,18H,3-7H2,1-2H3/t11-,12?,15?/m1/s1 |
| InChIKey | IOSHHVCOBYHIKR-XIKARTHZSA-N |
| XLogP | 4.85 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.26 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |