C14H19BrO2 — CID 103160598
1-(3-bromophenoxy)-3-cyclopentylpropan-2-ol (PubChem CID 103160598) has the molecular formula C14H19BrO2 and a molecular weight of 299.21 g/mol. Its IUPAC name is 1-(3-bromophenoxy)-3-cyclopentylpropan-2-ol.
| Compound Name | 1-(3-bromophenoxy)-3-cyclopentylpropan-2-ol |
|---|---|
| PubChem CID | 103160598 |
| Molecular Formula | C14H19BrO2 |
| Molecular Weight | 299.21 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | 1-(3-bromophenoxy)-3-cyclopentylpropan-2-ol |
| SMILES | OC(COc1cccc(Br)c1)CC1CCCC1 |
| InChI | InChI=1S/C14H19BrO2/c15-12-6-3-7-14(9-12)17-10-13(16)8-11-4-1-2-5-11/h3,6-7,9,11,13,16H,1-2,4-5,8,10H2 |
| InChIKey | BIWBLZKFVNLGIP-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.21 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |