C14H19BrO2 — CID 66321596
1-bromo-3-[2-(cyclopentylmethoxy)ethoxy]benzene (PubChem CID 66321596) has the molecular formula C14H19BrO2 and a molecular weight of 299.21 g/mol. Its IUPAC name is 1-bromo-3-[2-(cyclopentylmethoxy)ethoxy]benzene.
| Compound Name | 1-bromo-3-[2-(cyclopentylmethoxy)ethoxy]benzene |
|---|---|
| PubChem CID | 66321596 |
| Molecular Formula | C14H19BrO2 |
| Molecular Weight | 299.21 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | 1-bromo-3-[2-(cyclopentylmethoxy)ethoxy]benzene |
| SMILES | Brc1cccc(OCCOCC2CCCC2)c1 |
| InChI | InChI=1S/C14H19BrO2/c15-13-6-3-7-14(10-13)17-9-8-16-11-12-4-1-2-5-12/h3,6-7,10,12H,1-2,4-5,8-9,11H2 |
| InChIKey | HGXXRCVAXYHXBO-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.21 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|