C16H25BO4 — CID 114248720
[3-[2-(cycloheptylmethoxy)ethoxy]phenyl]boronic acid (PubChem CID 114248720) has the molecular formula C16H25BO4 and a molecular weight of 292.18 g/mol. Its IUPAC name is [3-[2-(cycloheptylmethoxy)ethoxy]phenyl]boronic acid.
| Compound Name | [3-[2-(cycloheptylmethoxy)ethoxy]phenyl]boronic acid |
|---|---|
| PubChem CID | 114248720 |
| Molecular Formula | C16H25BO4 |
| Molecular Weight | 292.18 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | [3-[2-(cycloheptylmethoxy)ethoxy]phenyl]boronic acid |
| SMILES | OB(O)c1cccc(OCCOCC2CCCCCC2)c1 |
| InChI | InChI=1S/C16H25BO4/c18-17(19)15-8-5-9-16(12-15)21-11-10-20-13-14-6-3-1-2-4-7-14/h5,8-9,12,14,18-19H,1-4,6-7,10-11,13H2 |
| InChIKey | ZRZSHLUBDLQGFI-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.18 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|