C16H26BNO3 — CID 83044828
[3-[2-(2-propylpiperidin-1-yl)ethoxy]phenyl]boronic acid (PubChem CID 83044828) has the molecular formula C16H26BNO3 and a molecular weight of 291.20 g/mol. Its IUPAC name is [3-[2-(2-propylpiperidin-1-yl)ethoxy]phenyl]boronic acid.
| Compound Name | [3-[2-(2-propylpiperidin-1-yl)ethoxy]phenyl]boronic acid |
|---|---|
| PubChem CID | 83044828 |
| Molecular Formula | C16H26BNO3 |
| Molecular Weight | 291.20 g/mol |
| Exact Mass | 291.20 |
| IUPAC Name | [3-[2-(2-propylpiperidin-1-yl)ethoxy]phenyl]boronic acid |
| SMILES | CCCC1CCCCN1CCOc1cccc(B(O)O)c1 |
| InChI | InChI=1S/C16H26BNO3/c1-2-6-15-8-3-4-10-18(15)11-12-21-16-9-5-7-14(13-16)17(19)20/h5,7,9,13,15,19-20H,2-4,6,8,10-12H2,1H3 |
| InChIKey | LLCUEHJCMBUGLO-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.20 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|