[3-[2-(2-propylpiperidin-1-yl)ethoxy]phenyl]boronic acid

C16H26BNO3 — CID 83044828

IUPAC[3-[2-(2-propylpiperidin-1-yl)ethoxy]phenyl]boronic acid
SMILESCCCC1CCCCN1CCOc1cccc(B(O)O)c1
InChIInChI=1S/C16H26BNO3/c1-2-6-15-8-3-4-10-18(15)11-12-21-16-9-5-7-14(13-16)17(19)20/h5,7,9,13,15,19-20H,2-4,6,8,10-12H2,1H3
InChIKeyLLCUEHJCMBUGLO-UHFFFAOYSA-N
MW291.20 g/mol
LogP1.40
Rot. Bonds7

About [3-[2-(2-propylpiperidin-1-yl)ethoxy]phenyl]boronic acid

[3-[2-(2-propylpiperidin-1-yl)ethoxy]phenyl]boronic acid (PubChem CID 83044828) has the molecular formula C16H26BNO3 and a molecular weight of 291.20 g/mol. Its IUPAC name is [3-[2-(2-propylpiperidin-1-yl)ethoxy]phenyl]boronic acid.

Molecular Properties

Compound Name[3-[2-(2-propylpiperidin-1-yl)ethoxy]phenyl]boronic acid
PubChem CID83044828
Molecular FormulaC16H26BNO3
Molecular Weight291.20 g/mol
Exact Mass291.20
IUPAC Name[3-[2-(2-propylpiperidin-1-yl)ethoxy]phenyl]boronic acid
SMILESCCCC1CCCCN1CCOc1cccc(B(O)O)c1
InChIInChI=1S/C16H26BNO3/c1-2-6-15-8-3-4-10-18(15)11-12-21-16-9-5-7-14(13-16)17(19)20/h5,7,9,13,15,19-20H,2-4,6,8,10-12H2,1H3
InChIKeyLLCUEHJCMBUGLO-UHFFFAOYSA-N
XLogP1.40
TPSA52.93 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds7
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500291.20
LogP ≤ 51.40
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze [3-[2-(2-propylpiperidin-1-yl)ethoxy]phenyl]boronic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [3-[2-(2-propylpiperidin-1-yl)ethoxy]phenyl]boronic acid?
The IUPAC name of [3-[2-(2-propylpiperidin-1-yl)ethoxy]phenyl]boronic acid (CID 83044828) is [3-[2-(2-propylpiperidin-1-yl)ethoxy]phenyl]boronic acid.
What is the SMILES notation for [3-[2-(2-propylpiperidin-1-yl)ethoxy]phenyl]boronic acid?
The canonical SMILES for [3-[2-(2-propylpiperidin-1-yl)ethoxy]phenyl]boronic acid is CCCC1CCCCN1CCOc1cccc(B(O)O)c1.
What is the InChIKey of [3-[2-(2-propylpiperidin-1-yl)ethoxy]phenyl]boronic acid?
The InChIKey is LLCUEHJCMBUGLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26BNO3/c1-2-6-15-8-3-4-10-18(15)11-12-21-16-9-5-7-14(13-16)17(19)20/h5,7,9,13,15,19-20H,2-4,6,8,10-12H2,1H3.
What are the key properties of [3-[2-(2-propylpiperidin-1-yl)ethoxy]phenyl]boronic acid?
[3-[2-(2-propylpiperidin-1-yl)ethoxy]phenyl]boronic acid has a molecular weight of 291.20 g/mol, XLogP of 1.40, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[2-(2-propylpiperidin-1-yl)ethoxy]phenyl]boronic acid is sourced from PubChem (CID 83044828), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).