C14H20FNO2 — CID 110892154
[1-[2-(3-fluorophenoxy)ethyl]piperidin-2-yl]methanol (PubChem CID 110892154) has the molecular formula C14H20FNO2 and a molecular weight of 253.32 g/mol. Its IUPAC name is [1-[2-(3-fluorophenoxy)ethyl]piperidin-2-yl]methanol.
| Compound Name | [1-[2-(3-fluorophenoxy)ethyl]piperidin-2-yl]methanol |
|---|---|
| PubChem CID | 110892154 |
| Molecular Formula | C14H20FNO2 |
| Molecular Weight | 253.32 g/mol |
| Exact Mass | 253.15 |
| IUPAC Name | [1-[2-(3-fluorophenoxy)ethyl]piperidin-2-yl]methanol |
| SMILES | OCC1CCCCN1CCOc1cccc(F)c1 |
| InChI | InChI=1S/C14H20FNO2/c15-12-4-3-6-14(10-12)18-9-8-16-7-2-1-5-13(16)11-17/h3-4,6,10,13,17H,1-2,5,7-9,11H2 |
| InChIKey | CZYCOTKNTSJMFN-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.32 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |